C17H25N3O4Si — CID 155574757
2-[[3-(1-ethoxyethenyl)-5-nitroindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 155574757) has the molecular formula C17H25N3O4Si and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-[[3-(1-ethoxyethenyl)-5-nitroindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(1-ethoxyethenyl)-5-nitroindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 155574757 |
| Molecular Formula | C17H25N3O4Si |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[[3-(1-ethoxyethenyl)-5-nitroindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C=C(OCC)c1nn(COCC[Si](C)(C)C)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H25N3O4Si/c1-6-24-13(2)17-15-11-14(20(21)22)7-8-16(15)19(18-17)12-23-9-10-25(3,4)5/h7-8,11H,2,6,9-10,12H2,1,3-5H3 |
| InChIKey | UXOGEYROEMAHMZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|