About CID 155575131
CID 155575131 (PubChem CID 155575131) has the molecular formula C7H5B2Y-
and a molecular weight of 199.65 g/mol.
Molecular Properties
| Compound Name | CID 155575131 |
| PubChem CID | 155575131 |
| Molecular Formula | C7H5B2Y- |
| Molecular Weight | 199.65 g/mol |
| Exact Mass | 199.96 |
| IUPAC Name | — |
| SMILES | [B]c1[c-]c([B])cc(C)c1.[Y] |
| InChI | InChI=1S/C7H5B2.Y/c1-5-2-6(8)4-7(9)3-5;/h2-3H,1H3;/q-1; |
| InChIKey | QKJCQCKURNQUGA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.65 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155575131 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155575131?
The IUPAC name of CID 155575131 (CID 155575131) is not available.
What is the SMILES notation for CID 155575131?
The canonical SMILES for CID 155575131 is [B]c1[c-]c([B])cc(C)c1.[Y].
What is the InChIKey of CID 155575131?
The InChIKey is QKJCQCKURNQUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5B2.Y/c1-5-2-6(8)4-7(9)3-5;/h2-3H,1H3;/q-1;.
What are the key properties of CID 155575131?
CID 155575131 has a molecular weight of 199.65 g/mol, XLogP of -0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155575131 is sourced from PubChem (CID 155575131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).