C34H38N2O8P2 — CID 155575502
2-[2-(3-methylphenyl)-3-[(2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-5-pentylphenoxy]-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 155575502) has the molecular formula C34H38N2O8P2 and a molecular weight of 664.63 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)-3-[(2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-5-pentylphenoxy]-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[2-(3-methylphenyl)-3-[(2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-5-pentylphenoxy]-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 155575502 |
| Molecular Formula | C34H38N2O8P2 |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 2-[2-(3-methylphenyl)-3-[(2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-5-pentylphenoxy]-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCCCCc1cc(OP2(=O)OCCC(c3ccncc3)O2)c(-c2cccc(C)c2)c(OP2(=O)OCCC(c3ccncc3)O2)c1 |
| InChI | InChI=1S/C34H38N2O8P2/c1-3-4-5-8-26-23-32(43-45(37)39-20-14-30(41-45)27-10-16-35-17-11-27)34(29-9-6-7-25(2)22-29)33(24-26)44-46(38)40-21-15-31(42-46)28-12-18-36-19-13-28/h6-7,9-13,16-19,22-24,30-31H,3-5,8,14-15,20-21H2,1-2H3 |
| InChIKey | HRRJHGOLMZEVRV-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|