C25H30ClNO4 — CID 155576355
9-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-(2,2-dimethylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 155576355) has the molecular formula C25H30ClNO4 and a molecular weight of 443.97 g/mol. Its IUPAC name is 9-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-(2,2-dimethylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-(2,2-dimethylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 155576355 |
| Molecular Formula | C25H30ClNO4 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 9-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-(2,2-dimethylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)CC3(CCN(C(=O)C(C)(C)C)CC3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C25H30ClNO4/c1-6-7-16-12-17(26)21(20(13-16)31-5)22-18(28)14-25(15-19(22)29)8-10-27(11-9-25)23(30)24(2,3)4/h12-13,22H,8-11,14-15H2,1-5H3 |
| InChIKey | MJKWNNBUXOBNES-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|