C10H10N4O2 — CID 15557652
(3S,3aR,6S,6aR)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropyrrolo[3,2-b]pyrrole-3,6-dicarbonitrile (PubChem CID 15557652) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropyrrolo[3,2-b]pyrrole-3,6-dicarbonitrile.
| Compound Name | (3S,3aR,6S,6aR)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropyrrolo[3,2-b]pyrrole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 15557652 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (3S,3aR,6S,6aR)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropyrrolo[3,2-b]pyrrole-3,6-dicarbonitrile |
| SMILES | C[C@]12NC(=O)[C@H](C#N)[C@@]1(C)NC(=O)[C@@H]2C#N |
| InChI | InChI=1S/C10H10N4O2/c1-9-5(3-11)7(15)14-10(9,2)6(4-12)8(16)13-9/h5-6H,1-2H3,(H,13,16)(H,14,15)/t5-,6-,9+,10+/m0/s1 |
| InChIKey | RQQONYJQDRGUDA-DWAQLAQLSA-N |
| XLogP | -0.96 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |