About 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine
2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine (PubChem CID 155576945) has the molecular formula C22H14Cl2N2
and a molecular weight of 377.27 g/mol. Its IUPAC name is 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine.
Molecular Properties
| Compound Name | 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine |
| PubChem CID | 155576945 |
| Molecular Formula | C22H14Cl2N2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)nc2Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2N2/c23-18-13-11-17(12-14-18)21-22(24)26-20(16-9-5-2-6-10-16)19(25-21)15-7-3-1-4-8-15/h1-14H |
| InChIKey | VURACUMXXIIPKT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine?
The IUPAC name of 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine (CID 155576945) is 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine.
What is the SMILES notation for 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine?
The canonical SMILES for 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine is Clc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)nc2Cl)cc1.
What is the InChIKey of 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine?
The InChIKey is VURACUMXXIIPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl2N2/c23-18-13-11-17(12-14-18)21-22(24)26-20(16-9-5-2-6-10-16)19(25-21)15-7-3-1-4-8-15/h1-14H.
What are the key properties of 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine?
2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine has a molecular weight of 377.27 g/mol, XLogP of 6.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(4-chlorophenyl)-5,6-diphenylpyrazine is sourced from PubChem (CID 155576945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).