C17H23BrFNO3 — CID 155577015
tert-butyl 5-[(4-bromophenyl)methyl]-2-(fluoromethyl)morpholine-4-carboxylate (PubChem CID 155577015) has the molecular formula C17H23BrFNO3 and a molecular weight of 388.28 g/mol. Its IUPAC name is tert-butyl 5-[(4-bromophenyl)methyl]-2-(fluoromethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 5-[(4-bromophenyl)methyl]-2-(fluoromethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 155577015 |
| Molecular Formula | C17H23BrFNO3 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | tert-butyl 5-[(4-bromophenyl)methyl]-2-(fluoromethyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CF)OCC1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H23BrFNO3/c1-17(2,3)23-16(21)20-10-15(9-19)22-11-14(20)8-12-4-6-13(18)7-5-12/h4-7,14-15H,8-11H2,1-3H3 |
| InChIKey | JYMMIIFBRDEORT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |