About CID 155577054
CID 155577054 (PubChem CID 155577054) has the molecular formula C8H7ClNOSi
and a molecular weight of 196.69 g/mol.
Molecular Properties
| Compound Name | CID 155577054 |
| PubChem CID | 155577054 |
| Molecular Formula | C8H7ClNOSi |
| Molecular Weight | 196.69 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | — |
| SMILES | O=[Si]/N=C/Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClNOSi/c9-8-3-1-7(2-4-8)5-6-10-12-11/h1-4,6H,5H2/b10-6+ |
| InChIKey | YJKAMIWGAKOAPC-UXBLZVDNSA-N |
| XLogP | 1.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 155577054 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155577054?
The IUPAC name of CID 155577054 (CID 155577054) is not available.
What is the SMILES notation for CID 155577054?
The canonical SMILES for CID 155577054 is O=[Si]/N=C/Cc1ccc(Cl)cc1.
What is the InChIKey of CID 155577054?
The InChIKey is YJKAMIWGAKOAPC-UXBLZVDNSA-N. The full InChI is InChI=1S/C8H7ClNOSi/c9-8-3-1-7(2-4-8)5-6-10-12-11/h1-4,6H,5H2/b10-6+.
What are the key properties of CID 155577054?
CID 155577054 has a molecular weight of 196.69 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155577054 is sourced from PubChem (CID 155577054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).