C23H29ClF6N6O2 — CID 155577116
3-[4-[5-[(4-chlorophenyl)methyl]-2-(2,2,2-trifluoroethyl)morpholin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;1,1,1-trifluoropropan-2-one (PubChem CID 155577116) has the molecular formula C23H29ClF6N6O2 and a molecular weight of 570.97 g/mol. Its IUPAC name is 3-[4-[5-[(4-chlorophenyl)methyl]-2-(2,2,2-trifluoroethyl)morpholin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[4-[5-[(4-chlorophenyl)methyl]-2-(2,2,2-trifluoroethyl)morpholin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 155577116 |
| Molecular Formula | C23H29ClF6N6O2 |
| Molecular Weight | 570.97 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 3-[4-[5-[(4-chlorophenyl)methyl]-2-(2,2,2-trifluoroethyl)morpholin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.Nc1nc(N2CCC(N3CC(CC(F)(F)F)OCC3Cc3ccc(Cl)cc3)CC2)n[nH]1 |
| InChI | InChI=1S/C20H26ClF3N6O.C3H3F3O/c21-14-3-1-13(2-4-14)9-16-12-31-17(10-20(22,23)24)11-30(16)15-5-7-29(8-6-15)19-26-18(25)27-28-19;1-2(7)3(4,5)6/h1-4,15-17H,5-12H2,(H3,25,26,27,28);1H3 |
| InChIKey | NKTXKWGWHRHGAL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |