C22H22N2O4 — CID 155577311
2'-(2,6-dimethyl-4-prop-1-ynylphenyl)spiro[6,8-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridine-7,5'-cyclohexane]-1',3,3'-trione (PubChem CID 155577311) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2'-(2,6-dimethyl-4-prop-1-ynylphenyl)spiro[6,8-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridine-7,5'-cyclohexane]-1',3,3'-trione.
| Compound Name | 2'-(2,6-dimethyl-4-prop-1-ynylphenyl)spiro[6,8-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridine-7,5'-cyclohexane]-1',3,3'-trione |
|---|---|
| PubChem CID | 155577311 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2'-(2,6-dimethyl-4-prop-1-ynylphenyl)spiro[6,8-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridine-7,5'-cyclohexane]-1',3,3'-trione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCn4c(noc4=O)C3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-4-5-15-8-13(2)19(14(3)9-15)20-16(25)10-22(11-17(20)26)6-7-24-18(12-22)23-28-21(24)27/h8-9,20H,6-7,10-12H2,1-3H3 |
| InChIKey | DXKKVOSJCXQEOJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|