C20H21NO3 — CID 155577352
8-(2,6-dimethyl-4-prop-1-ynylphenyl)-2-azaspiro[4.5]decane-3,7,9-trione (PubChem CID 155577352) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 8-(2,6-dimethyl-4-prop-1-ynylphenyl)-2-azaspiro[4.5]decane-3,7,9-trione.
| Compound Name | 8-(2,6-dimethyl-4-prop-1-ynylphenyl)-2-azaspiro[4.5]decane-3,7,9-trione |
|---|---|
| PubChem CID | 155577352 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 8-(2,6-dimethyl-4-prop-1-ynylphenyl)-2-azaspiro[4.5]decane-3,7,9-trione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CNC(=O)C3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C20H21NO3/c1-4-5-14-6-12(2)18(13(3)7-14)19-15(22)8-20(9-16(19)23)10-17(24)21-11-20/h6-7,19H,8-11H2,1-3H3,(H,21,24) |
| InChIKey | NRXYSXKCMLMDBX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|