C8H11NO3S — CID 155577667
2,3,4,5-tetrahydro-1-benzofuran-2-sulfonamide (PubChem CID 155577667) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1-benzofuran-2-sulfonamide.
| Compound Name | 2,3,4,5-tetrahydro-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 155577667 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2,3,4,5-tetrahydro-1-benzofuran-2-sulfonamide |
| SMILES | NS(=O)(=O)C1CC2=C(C=CCC2)O1 |
| InChI | InChI=1S/C8H11NO3S/c9-13(10,11)8-5-6-3-1-2-4-7(6)12-8/h2,4,8H,1,3,5H2,(H2,9,10,11) |
| InChIKey | GRFZIIWVQBZHOH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |