About (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane
(NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane (PubChem CID 155577913) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane.
Molecular Properties
| Compound Name | (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane |
| PubChem CID | 155577913 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane |
| SMILES | CC(C)C.Cc1cc2c(o1)CCC/C2=N/O |
| InChI | InChI=1S/C9H11NO2.C4H10/c1-6-5-7-8(10-11)3-2-4-9(7)12-6;1-4(2)3/h5,11H,2-4H2,1H3;4H,1-3H3/b10-8-; |
| InChIKey | WYGLPLYZDPUQEI-DQMXGCRQSA-N |
| XLogP | 3.76 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane?
The IUPAC name of (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane (CID 155577913) is (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane.
What is the SMILES notation for (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane?
The canonical SMILES for (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane is CC(C)C.Cc1cc2c(o1)CCC/C2=N/O.
What is the InChIKey of (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane?
The InChIKey is WYGLPLYZDPUQEI-DQMXGCRQSA-N. The full InChI is InChI=1S/C9H11NO2.C4H10/c1-6-5-7-8(10-11)3-2-4-9(7)12-6;1-4(2)3/h5,11H,2-4H2,1H3;4H,1-3H3/b10-8-;.
What are the key properties of (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane?
(NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane has a molecular weight of 223.32 g/mol, XLogP of 3.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(2-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)hydroxylamine;2-methylpropane is sourced from PubChem (CID 155577913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).