About 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one
3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one (PubChem CID 15557795) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 15557795 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1ccc2c(=O)c(Cc3ccccc3)c[nH]c2n1 |
| InChI | InChI=1S/C16H14N2O/c1-11-7-8-14-15(19)13(10-17-16(14)18-11)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,17,18,19) |
| InChIKey | QRUPNIJLOWMQBO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one (CID 15557795) is 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one is Cc1ccc2c(=O)c(Cc3ccccc3)c[nH]c2n1.
What is the InChIKey of 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one?
The InChIKey is QRUPNIJLOWMQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c1-11-7-8-14-15(19)13(10-17-16(14)18-11)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,17,18,19).
What are the key properties of 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one?
3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one has a molecular weight of 250.30 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-methyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 15557795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).