C14H17Cl — CID 155578127
4-chloro-8-ethyl-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 155578127) has the molecular formula C14H17Cl and a molecular weight of 220.74 g/mol. Its IUPAC name is 4-chloro-8-ethyl-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4-chloro-8-ethyl-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 155578127 |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-chloro-8-ethyl-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | CCc1c2c(c(Cl)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C14H17Cl/c1-2-9-10-5-3-7-12(10)14(15)13-8-4-6-11(9)13/h2-8H2,1H3 |
| InChIKey | WDUUXLAYIFEULA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |