C10H9F7N2O2S — CID 155578303
2,3,4,5-tetrafluoro-N,N-dimethyl-6-(2,2,2-trifluoroethylamino)benzenesulfonamide (PubChem CID 155578303) has the molecular formula C10H9F7N2O2S and a molecular weight of 354.25 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(2,2,2-trifluoroethylamino)benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(2,2,2-trifluoroethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 155578303 |
| Molecular Formula | C10H9F7N2O2S |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(2,2,2-trifluoroethylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1NCC(F)(F)F |
| InChI | InChI=1S/C10H9F7N2O2S/c1-19(2)22(20,21)9-7(14)5(12)4(11)6(13)8(9)18-3-10(15,16)17/h18H,3H2,1-2H3 |
| InChIKey | SMXDTQRNBVYVOR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|