C10H11F4NO3S — CID 155578405
2-ethoxy-3,4,5,6-tetrafluoro-N,N-dimethylbenzenesulfonamide (PubChem CID 155578405) has the molecular formula C10H11F4NO3S and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-ethoxy-3,4,5,6-tetrafluoro-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-ethoxy-3,4,5,6-tetrafluoro-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 155578405 |
| Molecular Formula | C10H11F4NO3S |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-ethoxy-3,4,5,6-tetrafluoro-N,N-dimethylbenzenesulfonamide |
| SMILES | CCOc1c(F)c(F)c(F)c(F)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H11F4NO3S/c1-4-18-9-7(13)5(11)6(12)8(14)10(9)19(16,17)15(2)3/h4H2,1-3H3 |
| InChIKey | ZVZWVKJXCADOFX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|