C8H7F4NO3S — CID 155578494
2,3,4,5-tetrafluoro-6-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 155578494) has the molecular formula C8H7F4NO3S and a molecular weight of 273.21 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-6-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 155578494 |
| Molecular Formula | C8H7F4NO3S |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(O)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H7F4NO3S/c1-13(2)17(15,16)8-6(12)4(10)3(9)5(11)7(8)14/h14H,1-2H3 |
| InChIKey | VXMYUVMLHDEXGS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|