About N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide
N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide (PubChem CID 155579260) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide.
Molecular Properties
| Compound Name | N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide |
| PubChem CID | 155579260 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide |
| SMILES | CNC(=O)c1cccc2c1C(=O)NC(=O)C2 |
| InChI | InChI=1S/C11H10N2O3/c1-12-10(15)7-4-2-3-6-5-8(14)13-11(16)9(6)7/h2-4H,5H2,1H3,(H,12,15)(H,13,14,16) |
| InChIKey | WYLBPKQIIRSOCV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide?
The IUPAC name of N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide (CID 155579260) is N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide.
What is the SMILES notation for N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide?
The canonical SMILES for N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide is CNC(=O)c1cccc2c1C(=O)NC(=O)C2.
What is the InChIKey of N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide?
The InChIKey is WYLBPKQIIRSOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c1-12-10(15)7-4-2-3-6-5-8(14)13-11(16)9(6)7/h2-4H,5H2,1H3,(H,12,15)(H,13,14,16).
What are the key properties of N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide?
N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide has a molecular weight of 218.21 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,3-dioxo-4H-isoquinoline-8-carboxamide is sourced from PubChem (CID 155579260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).