About 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine
6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 155579851) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine.
Molecular Properties
| Compound Name | 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine |
| PubChem CID | 155579851 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | CN1CCc2ncc(C3COC3)cc2C1 |
| InChI | InChI=1S/C12H16N2O/c1-14-3-2-12-10(6-14)4-9(5-13-12)11-7-15-8-11/h4-5,11H,2-3,6-8H2,1H3 |
| InChIKey | HWLNDJZMOJRPSD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine?
The IUPAC name of 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine (CID 155579851) is 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine.
What is the SMILES notation for 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine?
The canonical SMILES for 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine is CN1CCc2ncc(C3COC3)cc2C1.
What is the InChIKey of 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine?
The InChIKey is HWLNDJZMOJRPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-14-3-2-12-10(6-14)4-9(5-13-12)11-7-15-8-11/h4-5,11H,2-3,6-8H2,1H3.
What are the key properties of 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine?
6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine has a molecular weight of 204.27 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(oxetan-3-yl)-7,8-dihydro-5H-1,6-naphthyridine is sourced from PubChem (CID 155579851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).