About ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole
ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole (PubChem CID 155579876) has the molecular formula C15H20FN3O
and a molecular weight of 277.34 g/mol. Its IUPAC name is ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole |
| PubChem CID | 155579876 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole |
| SMILES | CC.Fc1ccc(-c2ncco2)cc1N1CCNCC1 |
| InChI | InChI=1S/C13H14FN3O.C2H6/c14-11-2-1-10(13-16-5-8-18-13)9-12(11)17-6-3-15-4-7-17;1-2/h1-2,5,8-9,15H,3-4,6-7H2;1-2H3 |
| InChIKey | NYBTXTBVVYDCIB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole?
The IUPAC name of ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole (CID 155579876) is ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole.
What is the SMILES notation for ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole?
The canonical SMILES for ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole is CC.Fc1ccc(-c2ncco2)cc1N1CCNCC1.
What is the InChIKey of ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole?
The InChIKey is NYBTXTBVVYDCIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O.C2H6/c14-11-2-1-10(13-16-5-8-18-13)9-12(11)17-6-3-15-4-7-17;1-2/h1-2,5,8-9,15H,3-4,6-7H2;1-2H3.
What are the key properties of ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole?
ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole has a molecular weight of 277.34 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-fluoro-3-piperazin-1-ylphenyl)-1,3-oxazole is sourced from PubChem (CID 155579876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).