C23H37ClN3O8P — CID 155579960
ethyl 2-[[(5S)-5-(2-chloro-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]-2-diethoxyphosphanylacetate;propane-2,2-diol (PubChem CID 155579960) has the molecular formula C23H37ClN3O8P and a molecular weight of 549.99 g/mol. Its IUPAC name is ethyl 2-[[(5S)-5-(2-chloro-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]-2-diethoxyphosphanylacetate;propane-2,2-diol.
| Compound Name | ethyl 2-[[(5S)-5-(2-chloro-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]-2-diethoxyphosphanylacetate;propane-2,2-diol |
|---|---|
| PubChem CID | 155579960 |
| Molecular Formula | C23H37ClN3O8P |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | ethyl 2-[[(5S)-5-(2-chloro-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]-2-diethoxyphosphanylacetate;propane-2,2-diol |
| SMILES | CC(C)(O)O.CCOC(=O)C(OCC1CC[C@@H](c2ccc3c(C)nc(Cl)nn23)O1)P(OCC)OCC |
| InChI | InChI=1S/C20H29ClN3O6P.C3H8O2/c1-5-26-18(25)19(31(28-6-2)29-7-3)27-12-14-8-11-17(30-14)16-10-9-15-13(4)22-20(21)23-24(15)16;1-3(2,4)5/h9-10,14,17,19H,5-8,11-12H2,1-4H3;4-5H,1-2H3/t14?,17-,19?;/m0./s1 |
| InChIKey | ZHQASUFYJSFWJF-LXHFDLMRSA-N |
| XLogP | 3.91 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|