C13H13F3N2O3S — CID 155580387
2-imino-3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 155580387) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-imino-3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155580387 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-imino-3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1cc(OC)ccc1COCC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O3S/c1-20-9-3-2-8(5-21-7-13(14,15)16)10(4-9)18-11(19)6-22-12(18)17/h2-4,17H,5-7H2,1H3/b17-12- |
| InChIKey | FBNOBTZEHOSGRE-ATVHPVEESA-N |
| XLogP | 2.79 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|