About 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide
4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide (PubChem CID 155580631) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide |
| PubChem CID | 155580631 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide |
| SMILES | CC/C=N/C(=N\C)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C12H17N3/c1-4-7-15-12(14-3)10-5-6-11(13)9(2)8-10/h5-8H,4,13H2,1-3H3/b14-12-,15-7+ |
| InChIKey | UTWXARVVTBRDNS-XSRVWSMQSA-N |
| XLogP | 2.43 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide?
The IUPAC name of 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide (CID 155580631) is 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide.
What is the SMILES notation for 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide?
The canonical SMILES for 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide is CC/C=N/C(=N\C)c1ccc(N)c(C)c1.
What is the InChIKey of 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide?
The InChIKey is UTWXARVVTBRDNS-XSRVWSMQSA-N. The full InChI is InChI=1S/C12H17N3/c1-4-7-15-12(14-3)10-5-6-11(13)9(2)8-10/h5-8H,4,13H2,1-3H3/b14-12-,15-7+.
What are the key properties of 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide?
4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide has a molecular weight of 203.29 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N',3-dimethyl-N-propylidenebenzenecarboximidamide is sourced from PubChem (CID 155580631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).