C20H23F3N4O — CID 155580650
2-methyl-4-[1-[(5Z,7E)-3-methyl-7-(trifluoromethoxy)nona-3,5,7-trien-4-yl]-1,2,4-triazol-3-yl]aniline (PubChem CID 155580650) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-methyl-4-[1-[(5Z,7E)-3-methyl-7-(trifluoromethoxy)nona-3,5,7-trien-4-yl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-methyl-4-[1-[(5Z,7E)-3-methyl-7-(trifluoromethoxy)nona-3,5,7-trien-4-yl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 155580650 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-methyl-4-[1-[(5Z,7E)-3-methyl-7-(trifluoromethoxy)nona-3,5,7-trien-4-yl]-1,2,4-triazol-3-yl]aniline |
| SMILES | C/C=C(\C=C/C(=C(C)CC)n1cnc(-c2ccc(N)c(C)c2)n1)OC(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O/c1-5-13(3)18(10-8-16(6-2)28-20(21,22)23)27-12-25-19(26-27)15-7-9-17(24)14(4)11-15/h6-12H,5,24H2,1-4H3/b10-8-,16-6+,18-13? |
| InChIKey | ANCGOUYJZBPQMA-HUZGENQPSA-N |
| XLogP | 5.47 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|