About CID 155581188
CID 155581188 (PubChem CID 155581188) has the molecular formula C13H19BNO4
and a molecular weight of 264.11 g/mol.
Molecular Properties
| Compound Name | CID 155581188 |
| PubChem CID | 155581188 |
| Molecular Formula | C13H19BNO4 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc([B]OC(C)(C)C(C)(C)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19BNO4/c1-9-6-7-10(11(8-9)15(17)18)14-19-13(4,5)12(2,3)16/h6-8,16H,1-5H3 |
| InChIKey | FSFPAKDXYKIXAR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 155581188 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155581188?
The IUPAC name of CID 155581188 (CID 155581188) is not available.
What is the SMILES notation for CID 155581188?
The canonical SMILES for CID 155581188 is Cc1ccc([B]OC(C)(C)C(C)(C)O)c([N+](=O)[O-])c1.
What is the InChIKey of CID 155581188?
The InChIKey is FSFPAKDXYKIXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BNO4/c1-9-6-7-10(11(8-9)15(17)18)14-19-13(4,5)12(2,3)16/h6-8,16H,1-5H3.
What are the key properties of CID 155581188?
CID 155581188 has a molecular weight of 264.11 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155581188 is sourced from PubChem (CID 155581188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).