C17H12F6N4 — CID 155581622
4-[1-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-methylaniline (PubChem CID 155581622) has the molecular formula C17H12F6N4 and a molecular weight of 386.30 g/mol. Its IUPAC name is 4-[1-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-methylaniline.
| Compound Name | 4-[1-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 155581622 |
| Molecular Formula | C17H12F6N4 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-[1-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-methylaniline |
| SMILES | Cc1cc(-c2ncn(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)ccc1N |
| InChI | InChI=1S/C17H12F6N4/c1-9-4-10(2-3-14(9)24)15-25-8-27(26-15)13-6-11(16(18,19)20)5-12(7-13)17(21,22)23/h2-8H,24H2,1H3 |
| InChIKey | QZXUEXYEWBAESG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|