About 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide
9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide (PubChem CID 155581688) has the molecular formula C12H9N3O2
and a molecular weight of 227.22 g/mol. Its IUPAC name is 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide |
| PubChem CID | 155581688 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc2cccc(O)c2n2ccnc12 |
| InChI | InChI=1S/C12H9N3O2/c13-11(17)8-6-7-2-1-3-9(16)10(7)15-5-4-14-12(8)15/h1-6,16H,(H2,13,17) |
| InChIKey | JVCRMHINYDYYGH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide?
The IUPAC name of 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide (CID 155581688) is 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide.
What is the SMILES notation for 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide?
The canonical SMILES for 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide is NC(=O)c1cc2cccc(O)c2n2ccnc12.
What is the InChIKey of 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide?
The InChIKey is JVCRMHINYDYYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2/c13-11(17)8-6-7-2-1-3-9(16)10(7)15-5-4-14-12(8)15/h1-6,16H,(H2,13,17).
What are the key properties of 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide?
9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide has a molecular weight of 227.22 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxyimidazo[1,2-a]quinoline-4-carboxamide is sourced from PubChem (CID 155581688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).