C39H38F3N7O5 — CID 155582717
8-[2-[2-[2-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethyl]phenoxy]isoquinoline-1,3,4-trione (PubChem CID 155582717) has the molecular formula C39H38F3N7O5 and a molecular weight of 741.77 g/mol. Its IUPAC name is 8-[2-[2-[2-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethyl]phenoxy]isoquinoline-1,3,4-trione.
| Compound Name | 8-[2-[2-[2-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethyl]phenoxy]isoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 155582717 |
| Molecular Formula | C39H38F3N7O5 |
| Molecular Weight | 741.77 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 8-[2-[2-[2-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethyl]phenoxy]isoquinoline-1,3,4-trione |
| SMILES | O=C1NC(=O)c2c(Oc3ccccc3CCOCCN3CCN(Cc4ccc(-c5c[nH]c6nc(NCCC(F)(F)F)ncc56)cc4)CC3)cccc2C1=O |
| InChI | InChI=1S/C39H38F3N7O5/c40-39(41,42)13-14-43-38-45-23-30-29(22-44-35(30)46-38)26-10-8-25(9-11-26)24-49-17-15-48(16-18-49)19-21-53-20-12-27-4-1-2-6-31(27)54-32-7-3-5-28-33(32)36(51)47-37(52)34(28)50/h1-11,22-23H,12-21,24H2,(H,47,51,52)(H2,43,44,45,46) |
| InChIKey | YYVRIJREMUTZFI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|