C41H44F3N7O4 — CID 155582742
8-[3-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]-4H-isoquinoline-1,3-dione (PubChem CID 155582742) has the molecular formula C41H44F3N7O4 and a molecular weight of 755.84 g/mol. Its IUPAC name is 8-[3-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]-4H-isoquinoline-1,3-dione.
| Compound Name | 8-[3-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 155582742 |
| Molecular Formula | C41H44F3N7O4 |
| Molecular Weight | 755.84 g/mol |
| Exact Mass | 755.34 |
| IUPAC Name | 8-[3-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]-4H-isoquinoline-1,3-dione |
| SMILES | O=C1Cc2cccc(Oc3cccc(CCCOCCCN4CCN(Cc5ccc(-c6c[nH]c7nc(NCCC(F)(F)F)ncc67)cc5)CC4)c3)c2C(=O)N1 |
| InChI | InChI=1S/C41H44F3N7O4/c42-41(43,44)14-15-45-40-47-26-34-33(25-46-38(34)49-40)30-12-10-29(11-13-30)27-51-19-17-50(18-20-51)16-4-22-54-21-3-6-28-5-1-8-32(23-28)55-35-9-2-7-31-24-36(52)48-39(53)37(31)35/h1-2,5,7-13,23,25-26H,3-4,6,14-22,24,27H2,(H,48,52,53)(H2,45,46,47,49) |
| InChIKey | KGHWKNSRAIQCCC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.84 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|