C41H42F3N7O5 — CID 155582759
8-[2-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]isoquinoline-1,3,4-trione (PubChem CID 155582759) has the molecular formula C41H42F3N7O5 and a molecular weight of 769.83 g/mol. Its IUPAC name is 8-[2-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]isoquinoline-1,3,4-trione.
| Compound Name | 8-[2-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]isoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 155582759 |
| Molecular Formula | C41H42F3N7O5 |
| Molecular Weight | 769.83 g/mol |
| Exact Mass | 769.32 |
| IUPAC Name | 8-[2-[3-[3-[4-[[4-[2-(3,3,3-trifluoropropylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]methyl]piperazin-1-yl]propoxy]propyl]phenoxy]isoquinoline-1,3,4-trione |
| SMILES | O=C1NC(=O)c2c(Oc3ccccc3CCCOCCCN3CCN(Cc4ccc(-c5c[nH]c6nc(NCCC(F)(F)F)ncc56)cc4)CC3)cccc2C1=O |
| InChI | InChI=1S/C41H42F3N7O5/c42-41(43,44)15-16-45-40-47-25-32-31(24-46-37(32)48-40)28-13-11-27(12-14-28)26-51-20-18-50(19-21-51)17-5-23-55-22-4-7-29-6-1-2-9-33(29)56-34-10-3-8-30-35(34)38(53)49-39(54)36(30)52/h1-3,6,8-14,24-25H,4-5,7,15-23,26H2,(H,49,53,54)(H2,45,46,47,48) |
| InChIKey | KSILELLJOVXORY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.83 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|