C7H8N2O2Rb2 — CID 155582833
N-methyl-4-oxo-2,3-dihydropyridine-1,3-diide-5-carboxamide;bis(rubidium(1+)) (PubChem CID 155582833) has the molecular formula C7H8N2O2Rb2 and a molecular weight of 323.09 g/mol. Its IUPAC name is N-methyl-4-oxo-2,3-dihydropyridine-1,3-diide-5-carboxamide;bis(rubidium(1+)).
| Compound Name | N-methyl-4-oxo-2,3-dihydropyridine-1,3-diide-5-carboxamide;bis(rubidium(1+)) |
|---|---|
| PubChem CID | 155582833 |
| Molecular Formula | C7H8N2O2Rb2 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | N-methyl-4-oxo-2,3-dihydropyridine-1,3-diide-5-carboxamide;bis(rubidium(1+)) |
| SMILES | CNC(=O)C1=C[N-]C[CH-]C1=O.[Rb+].[Rb+] |
| InChI | InChI=1S/C7H9N2O2.2Rb/c1-8-7(11)5-4-9-3-2-6(5)10;;/h2,4H,3H2,1H3,(H2,8,9,10,11);;/q-1;2*+1/p-1 |
| InChIKey | MLRGPRTYBXTSGG-UHFFFAOYSA-M |
| XLogP | -6.22 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | -6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|