C26H37N3O3S — CID 155582914
isoquinolin-6-amine;molecular hydrogen;2-(trimethyl-λ4-sulfanyl)ethyl N-[2-(3,4-dimethylphenyl)-3-oxopropyl]carbamate (PubChem CID 155582914) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is isoquinolin-6-amine;molecular hydrogen;2-(trimethyl-λ4-sulfanyl)ethyl N-[2-(3,4-dimethylphenyl)-3-oxopropyl]carbamate.
| Compound Name | isoquinolin-6-amine;molecular hydrogen;2-(trimethyl-λ4-sulfanyl)ethyl N-[2-(3,4-dimethylphenyl)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 155582914 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | isoquinolin-6-amine;molecular hydrogen;2-(trimethyl-λ4-sulfanyl)ethyl N-[2-(3,4-dimethylphenyl)-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(C(C=O)CNC(=O)OCCS(C)(C)C)cc1C.Nc1ccc2cnccc2c1.[H][H] |
| InChI | InChI=1S/C17H27NO3S.C9H8N2.H2/c1-13-6-7-15(10-14(13)2)16(12-19)11-18-17(20)21-8-9-22(3,4)5;10-9-2-1-8-6-11-4-3-7(8)5-9;/h6-7,10,12,16H,8-9,11H2,1-5H3,(H,18,20);1-6H,10H2;1H |
| InChIKey | GGTXNSWWQSEEJO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|