C22H29N — CID 155583111
(2Z)-2-[4-[(3E)-4,6-dimethylhepta-1,3-dien-3-yl]-3-methylphenyl]-N-methylpenta-2,4-dien-1-imine (PubChem CID 155583111) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is (2Z)-2-[4-[(3E)-4,6-dimethylhepta-1,3-dien-3-yl]-3-methylphenyl]-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[4-[(3E)-4,6-dimethylhepta-1,3-dien-3-yl]-3-methylphenyl]-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 155583111 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (2Z)-2-[4-[(3E)-4,6-dimethylhepta-1,3-dien-3-yl]-3-methylphenyl]-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C)c1ccc(/C(C=C)=C(\C)CC(C)C)c(C)c1 |
| InChI | InChI=1S/C22H29N/c1-8-10-20(15-23-7)19-11-12-22(18(6)14-19)21(9-2)17(5)13-16(3)4/h8-12,14-16H,1-2,13H2,3-7H3/b20-10+,21-17+,23-15+ |
| InChIKey | MXHAWXSVTPCWSQ-OJFLHAJZSA-N |
| XLogP | 6.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|