About 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride
10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride (PubChem CID 15558347) has the molecular formula C14H15Cl2N3
and a molecular weight of 296.20 g/mol. Its IUPAC name is 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride.
Molecular Properties
| Compound Name | 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride |
| PubChem CID | 15558347 |
| Molecular Formula | C14H15Cl2N3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride |
| SMILES | C[n+]1c2cc(N)ccc2cc2ccc(N)cc21.Cl.[Cl-] |
| InChI | InChI=1S/C14H13N3.2ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;;/h2-8H,1H3,(H3,15,16);2*1H |
| InChIKey | OEGQPXPIKZELFM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride?
The IUPAC name of 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride (CID 15558347) is 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride.
What is the SMILES notation for 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride?
The canonical SMILES for 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride is C[n+]1c2cc(N)ccc2cc2ccc(N)cc21.Cl.[Cl-].
What is the InChIKey of 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride?
The InChIKey is OEGQPXPIKZELFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3.2ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;;/h2-8H,1H3,(H3,15,16);2*1H.
What are the key properties of 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride?
10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride has a molecular weight of 296.20 g/mol, XLogP of -0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylacridin-10-ium-3,6-diamine;chloride;hydrochloride is sourced from PubChem (CID 15558347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).