C15H21N2O3W- — CID 155583810
ethane;N-(3-methyl-2,6-dioxopiperidin-3-yl)cyclohexa-1,5-diene-1-carboxamide;tungsten (PubChem CID 155583810) has the molecular formula C15H21N2O3W- and a molecular weight of 461.18 g/mol. Its IUPAC name is ethane;N-(3-methyl-2,6-dioxopiperidin-3-yl)cyclohexa-1,5-diene-1-carboxamide;tungsten.
| Compound Name | ethane;N-(3-methyl-2,6-dioxopiperidin-3-yl)cyclohexa-1,5-diene-1-carboxamide;tungsten |
|---|---|
| PubChem CID | 155583810 |
| Molecular Formula | C15H21N2O3W- |
| Molecular Weight | 461.18 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | ethane;N-(3-methyl-2,6-dioxopiperidin-3-yl)cyclohexa-1,5-diene-1-carboxamide;tungsten |
| SMILES | CC.CC1(NC(=O)C2=CCCC=[C-]2)CCC(=O)NC1=O.[W] |
| InChI | InChI=1S/C13H15N2O3.C2H6.W/c1-13(8-7-10(16)14-12(13)18)15-11(17)9-5-3-2-4-6-9;1-2;/h3,6H,2,4,7-8H2,1H3,(H,15,17)(H,14,16,18);1-2H3;/q-1;; |
| InChIKey | XYYGUIJUXSUQPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|