C13H16O — CID 15558457
(5E,11E)-trideca-5,11-dien-7,9-diyn-4-ol (PubChem CID 15558457) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (5E,11E)-trideca-5,11-dien-7,9-diyn-4-ol.
| Compound Name | (5E,11E)-trideca-5,11-dien-7,9-diyn-4-ol |
|---|---|
| PubChem CID | 15558457 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (5E,11E)-trideca-5,11-dien-7,9-diyn-4-ol |
| SMILES | C/C=C/C#CC#C/C=C/C(O)CCC |
| InChI | InChI=1S/C13H16O/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h3,5,10,12-14H,4,11H2,1-2H3/b5-3+,12-10+ |
| InChIKey | GEENZQOWBUUIOA-RHMTYFIUSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|