C29H39NO — CID 155584649
4-butan-2-yl-5-[4-[(2E,4Z,6Z)-6-cyclobutyloxynona-2,4,6-trien-3-yl]-2-methylphenyl]-2,3-dihydropyridine (PubChem CID 155584649) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is 4-butan-2-yl-5-[4-[(2E,4Z,6Z)-6-cyclobutyloxynona-2,4,6-trien-3-yl]-2-methylphenyl]-2,3-dihydropyridine.
| Compound Name | 4-butan-2-yl-5-[4-[(2E,4Z,6Z)-6-cyclobutyloxynona-2,4,6-trien-3-yl]-2-methylphenyl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 155584649 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 4-butan-2-yl-5-[4-[(2E,4Z,6Z)-6-cyclobutyloxynona-2,4,6-trien-3-yl]-2-methylphenyl]-2,3-dihydropyridine |
| SMILES | C/C=C(\C=C/C(=C/CC)OC1CCC1)c1ccc(C2=C(C(C)CC)CCN=C2)c(C)c1 |
| InChI | InChI=1S/C29H39NO/c1-6-10-25(31-26-11-9-12-26)15-13-23(8-3)24-14-16-27(22(5)19-24)29-20-30-18-17-28(29)21(4)7-2/h8,10,13-16,19-21,26H,6-7,9,11-12,17-18H2,1-5H3/b15-13-,23-8+,25-10- |
| InChIKey | TUIZGEOROCDTAV-SSSRXXHRSA-N |
| XLogP | 8.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|