C32H44N4 — CID 15558479
2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-5,10,15,20,21,22,23,24-octahydroporphyrin (PubChem CID 15558479) has the molecular formula C32H44N4 and a molecular weight of 484.73 g/mol. Its IUPAC name is 2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-5,10,15,20,21,22,23,24-octahydroporphyrin.
| Compound Name | 2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-5,10,15,20,21,22,23,24-octahydroporphyrin |
|---|---|
| PubChem CID | 15558479 |
| Molecular Formula | C32H44N4 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | 2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-5,10,15,20,21,22,23,24-octahydroporphyrin |
| SMILES | CCc1c2[nH]c(c1C)Cc1[nH]c(c(C)c1CC)Cc1[nH]c(c(C)c1CC)Cc1[nH]c(c(C)c1CC)C2 |
| InChI | InChI=1S/C32H44N4/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25/h33-36H,9-16H2,1-8H3 |
| InChIKey | HZTUWFMYXOMBJC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |