C21H24BrNO4 — CID 155584816
2-[4-[5-[3-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]oxycyclobutyl]oxy-2-pyridinyl]but-3-yn-2-yloxy]ethanol (PubChem CID 155584816) has the molecular formula C21H24BrNO4 and a molecular weight of 434.33 g/mol. Its IUPAC name is 2-[4-[5-[3-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]oxycyclobutyl]oxy-2-pyridinyl]but-3-yn-2-yloxy]ethanol.
| Compound Name | 2-[4-[5-[3-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]oxycyclobutyl]oxy-2-pyridinyl]but-3-yn-2-yloxy]ethanol |
|---|---|
| PubChem CID | 155584816 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-[4-[5-[3-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]oxycyclobutyl]oxy-2-pyridinyl]but-3-yn-2-yloxy]ethanol |
| SMILES | C=C(Br)/C=C\C(=C)OC1CC(Oc2ccc(C#CC(C)OCCO)nc2)C1 |
| InChI | InChI=1S/C21H24BrNO4/c1-15(22)4-5-17(3)26-20-12-21(13-20)27-19-9-8-18(23-14-19)7-6-16(2)25-11-10-24/h4-5,8-9,14,16,20-21,24H,1,3,10-13H2,2H3/b5-4- |
| InChIKey | JACDGYCVFLTZLC-PLNGDYQASA-N |
| XLogP | 3.74 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|