About 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine
7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine (PubChem CID 155584881) has the molecular formula C29H43N3O
and a molecular weight of 449.68 g/mol. Its IUPAC name is 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine.
Molecular Properties
| Compound Name | 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine |
| PubChem CID | 155584881 |
| Molecular Formula | C29H43N3O |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine |
| SMILES | CC1CC(OC2CCNCC2)C1.CCCC(CCC)c1ccc2c3cnccc3n(C)c2c1 |
| InChI | InChI=1S/C19H24N2.C10H19NO/c1-4-6-14(7-5-2)15-8-9-16-17-13-20-11-10-18(17)21(3)19(16)12-15;1-8-6-10(7-8)12-9-2-4-11-5-3-9/h8-14H,4-7H2,1-3H3;8-11H,2-7H2,1H3 |
| InChIKey | LFDJNXCNGBHRET-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine?
The IUPAC name of 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine (CID 155584881) is 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine.
What is the SMILES notation for 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine?
The canonical SMILES for 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine is CC1CC(OC2CCNCC2)C1.CCCC(CCC)c1ccc2c3cnccc3n(C)c2c1.
What is the InChIKey of 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine?
The InChIKey is LFDJNXCNGBHRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2.C10H19NO/c1-4-6-14(7-5-2)15-8-9-16-17-13-20-11-10-18(17)21(3)19(16)12-15;1-8-6-10(7-8)12-9-2-4-11-5-3-9/h8-14H,4-7H2,1-3H3;8-11H,2-7H2,1H3.
What are the key properties of 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine?
7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine has a molecular weight of 449.68 g/mol, XLogP of 6.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-heptan-4-yl-5-methylpyrido[4,3-b]indole;4-(3-methylcyclobutyl)oxypiperidine is sourced from PubChem (CID 155584881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).