C20H21F3N4O3 — CID 155585098
ethane;N-hydroxy-N,3-dimethyl-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide (PubChem CID 155585098) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is ethane;N-hydroxy-N,3-dimethyl-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide.
| Compound Name | ethane;N-hydroxy-N,3-dimethyl-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155585098 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethane;N-hydroxy-N,3-dimethyl-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide |
| SMILES | CC.Cc1cc(Nc2ncc(-c3ccc(C(F)(F)F)cc3)o2)cnc1C(=O)N(C)O |
| InChI | InChI=1S/C18H15F3N4O3.C2H6/c1-10-7-13(8-22-15(10)16(26)25(2)27)24-17-23-9-14(28-17)11-3-5-12(6-4-11)18(19,20)21;1-2/h3-9,27H,1-2H3,(H,23,24);1-2H3 |
| InChIKey | DFVJVOFSPJOEGX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|