About 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile
6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile (PubChem CID 155585129) has the molecular formula C14H7F2N5O
and a molecular weight of 299.24 g/mol. Its IUPAC name is 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile |
| PubChem CID | 155585129 |
| Molecular Formula | C14H7F2N5O |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(-c3ccc(F)c(F)c3)o2)nn1 |
| InChI | InChI=1S/C14H7F2N5O/c15-10-3-1-8(5-11(10)16)12-7-18-14(22-12)19-13-4-2-9(6-17)20-21-13/h1-5,7H,(H,18,19,21) |
| InChIKey | YEIBEXRNJXMJEQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile?
The IUPAC name of 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile (CID 155585129) is 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile.
What is the SMILES notation for 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile?
The canonical SMILES for 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile is N#Cc1ccc(Nc2ncc(-c3ccc(F)c(F)c3)o2)nn1.
What is the InChIKey of 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile?
The InChIKey is YEIBEXRNJXMJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F2N5O/c15-10-3-1-8(5-11(10)16)12-7-18-14(22-12)19-13-4-2-9(6-17)20-21-13/h1-5,7H,(H,18,19,21).
What are the key properties of 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile?
6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile has a molecular weight of 299.24 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-(3,4-difluorophenyl)-1,3-oxazol-2-yl]amino]pyridazine-3-carbonitrile is sourced from PubChem (CID 155585129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).