About ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine
ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine (PubChem CID 155585154) has the molecular formula C17H17F3N4O
and a molecular weight of 350.34 g/mol. Its IUPAC name is ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine.
Molecular Properties
| Compound Name | ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine |
| PubChem CID | 155585154 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine |
| SMILES | CC.Nc1ccc(Nc2ncc(-c3ccc(C(F)(F)F)cc3)o2)cn1 |
| InChI | InChI=1S/C15H11F3N4O.C2H6/c16-15(17,18)10-3-1-9(2-4-10)12-8-21-14(23-12)22-11-5-6-13(19)20-7-11;1-2/h1-8H,(H2,19,20)(H,21,22);1-2H3 |
| InChIKey | AHFKHKHUIZVWGL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine?
The IUPAC name of ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine (CID 155585154) is ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine.
What is the SMILES notation for ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine?
The canonical SMILES for ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine is CC.Nc1ccc(Nc2ncc(-c3ccc(C(F)(F)F)cc3)o2)cn1.
What is the InChIKey of ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine?
The InChIKey is AHFKHKHUIZVWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N4O.C2H6/c16-15(17,18)10-3-1-9(2-4-10)12-8-21-14(23-12)22-11-5-6-13(19)20-7-11;1-2/h1-8H,(H2,19,20)(H,21,22);1-2H3.
What are the key properties of ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine?
ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine has a molecular weight of 350.34 g/mol, XLogP of 5.11, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]pyridine-2,5-diamine is sourced from PubChem (CID 155585154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).