About 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile
5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile (PubChem CID 155585351) has the molecular formula C14H8ClN5O
and a molecular weight of 297.71 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile |
| PubChem CID | 155585351 |
| Molecular Formula | C14H8ClN5O |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ncc(-c3ccc(Cl)cc3)o2)cn1 |
| InChI | InChI=1S/C14H8ClN5O/c15-10-3-1-9(2-4-10)12-7-19-14(21-12)20-13-8-17-11(5-16)6-18-13/h1-4,6-8H,(H,18,19,20) |
| InChIKey | ZWJQXEKCJDWXEU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile?
The IUPAC name of 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile (CID 155585351) is 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile?
The canonical SMILES for 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile is N#Cc1cnc(Nc2ncc(-c3ccc(Cl)cc3)o2)cn1.
What is the InChIKey of 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile?
The InChIKey is ZWJQXEKCJDWXEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClN5O/c15-10-3-1-9(2-4-10)12-7-19-14(21-12)20-13-8-17-11(5-16)6-18-13/h1-4,6-8H,(H,18,19,20).
What are the key properties of 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile?
5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile has a molecular weight of 297.71 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]pyrazine-2-carbonitrile is sourced from PubChem (CID 155585351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).