C11H22F3NO — CID 155585642
ethane;4-methyl-1-(2,2,2-trifluoroethyl)azepan-4-ol (PubChem CID 155585642) has the molecular formula C11H22F3NO and a molecular weight of 241.30 g/mol. Its IUPAC name is ethane;4-methyl-1-(2,2,2-trifluoroethyl)azepan-4-ol.
| Compound Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)azepan-4-ol |
|---|---|
| PubChem CID | 155585642 |
| Molecular Formula | C11H22F3NO |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)azepan-4-ol |
| SMILES | CC.CC1(O)CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H16F3NO.C2H6/c1-8(14)3-2-5-13(6-4-8)7-9(10,11)12;1-2/h14H,2-7H2,1H3;1-2H3 |
| InChIKey | XPRRHDIZPTUZGS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |