About ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide
ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide (PubChem CID 155585859) has the molecular formula C8H12F3N3O
and a molecular weight of 223.20 g/mol. Its IUPAC name is ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide |
| PubChem CID | 155585859 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide |
| SMILES | CC.NC(=O)c1ccnc(C(F)(F)F)n1.[H][H] |
| InChI | InChI=1S/C6H4F3N3O.C2H6.H2/c7-6(8,9)5-11-2-1-3(12-5)4(10)13;1-2;/h1-2H,(H2,10,13);1-2H3;1H |
| InChIKey | IPLNRXFFJQOWDX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide?
The IUPAC name of ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide (CID 155585859) is ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide.
What is the SMILES notation for ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide?
The canonical SMILES for ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide is CC.NC(=O)c1ccnc(C(F)(F)F)n1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide?
The InChIKey is IPLNRXFFJQOWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N3O.C2H6.H2/c7-6(8,9)5-11-2-1-3(12-5)4(10)13;1-2;/h1-2H,(H2,10,13);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide?
ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide has a molecular weight of 223.20 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;2-(trifluoromethyl)pyrimidine-4-carboxamide is sourced from PubChem (CID 155585859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).