C28H40N+ — CID 155586173
3,3-bis(3,4,5-trimethylphenyl)-6-azoniaspiro[5.5]undecane (PubChem CID 155586173) has the molecular formula C28H40N+ and a molecular weight of 390.64 g/mol. Its IUPAC name is 3,3-bis(3,4,5-trimethylphenyl)-6-azoniaspiro[5.5]undecane.
| Compound Name | 3,3-bis(3,4,5-trimethylphenyl)-6-azoniaspiro[5.5]undecane |
|---|---|
| PubChem CID | 155586173 |
| Molecular Formula | C28H40N+ |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 3,3-bis(3,4,5-trimethylphenyl)-6-azoniaspiro[5.5]undecane |
| SMILES | Cc1cc(C2(c3cc(C)c(C)c(C)c3)CC[N+]3(CCCCC3)CC2)cc(C)c1C |
| InChI | InChI=1S/C28H40N/c1-20-16-26(17-21(2)24(20)5)28(27-18-22(3)25(6)23(4)19-27)10-14-29(15-11-28)12-8-7-9-13-29/h16-19H,7-15H2,1-6H3/q+1 |
| InChIKey | ACBMWSOMZZYAIC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|