About (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine
(2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine (PubChem CID 15558621) has the molecular formula C18H22N2S
and a molecular weight of 298.45 g/mol. Its IUPAC name is (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine.
Molecular Properties
| Compound Name | (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine |
| PubChem CID | 15558621 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine |
| SMILES | C[C@H](CN(C)C)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | ZZHLYYDVIOPZBE-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine?
The IUPAC name of (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine (CID 15558621) is (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine.
What is the SMILES notation for (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine?
The canonical SMILES for (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine is C[C@H](CN(C)C)CN1c2ccccc2Sc2ccccc21.
What is the InChIKey of (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine?
The InChIKey is ZZHLYYDVIOPZBE-CQSZACIVSA-N. The full InChI is InChI=1S/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3/t14-/m1/s1.
What are the key properties of (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine?
(2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine has a molecular weight of 298.45 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine is sourced from PubChem (CID 15558621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).