C18H28N4O — CID 155586454
(Z)-3-amino-4,4-dimethyl-N'-[4-(morpholin-4-ylmethyl)phenyl]pent-2-enimidamide (PubChem CID 155586454) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (Z)-3-amino-4,4-dimethyl-N'-[4-(morpholin-4-ylmethyl)phenyl]pent-2-enimidamide.
| Compound Name | (Z)-3-amino-4,4-dimethyl-N'-[4-(morpholin-4-ylmethyl)phenyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 155586454 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (Z)-3-amino-4,4-dimethyl-N'-[4-(morpholin-4-ylmethyl)phenyl]pent-2-enimidamide |
| SMILES | CC(C)(C)/C(N)=C/C(N)=N/c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C18H28N4O/c1-18(2,3)16(19)12-17(20)21-15-6-4-14(5-7-15)13-22-8-10-23-11-9-22/h4-7,12H,8-11,13,19H2,1-3H3,(H2,20,21)/b16-12- |
| InChIKey | AIUBIFCNBIZHDC-VBKFSLOCSA-N |
| XLogP | 2.40 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|